2-Naphthalenesulfonicacid, hydrazide structure
|
Common Name | 2-Naphthalenesulfonicacid, hydrazide | ||
|---|---|---|---|---|
| CAS Number | 10151-46-9 | Molecular Weight | 222.26400 | |
| Density | 1.377g/cm3 | Boiling Point | 438.4ºC at 760mmHg | |
| Molecular Formula | C10H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.9ºC | |
| Name | naphthalene-2-sulfonohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 438.4ºC at 760mmHg |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.26400 |
| Flash Point | 218.9ºC |
| Exact Mass | 222.04600 |
| PSA | 80.57000 |
| LogP | 3.16380 |
| Vapour Pressure | 6.94E-08mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | OPTPEWSLEFFPTF-UHFFFAOYSA-N |
| SMILES | NNS(=O)(=O)c1ccc2ccccc2c1 |
| HS Code | 2935009090 |
|---|
|
~96%
2-Naphthalenesu... CAS#:10151-46-9 |
| Literature: Luzina, Elena L.; Popov, Anatoliy V. Journal of Fluorine Chemistry, 2013 , vol. 148, p. 41 - 48 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 2-naphthylsulfonylhydrazine |
| hydrazino-2-naphthylsulfone |
| naphthalene-2-sulfonic acid hydrazide |
| Naphthalin-2-sulfonsaeure-hydrazid |
| 2-naphthalenesulfonohydrazide |