2-Naphthalenesulfonicacid, 7-[(3-aminobenzoyl)amino]-4-hydroxy- structure
|
Common Name | 2-Naphthalenesulfonicacid, 7-[(3-aminobenzoyl)amino]-4-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 118-50-3 | Molecular Weight | 358.36800 | |
| Density | 1.586g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-[(3-aminobenzoyl)amino]-4-hydroxynaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.586g/cm3 |
|---|---|
| Molecular Formula | C17H14N2O5S |
| Molecular Weight | 358.36800 |
| Exact Mass | 358.06200 |
| PSA | 138.10000 |
| LogP | 4.36160 |
| Index of Refraction | 1.759 |
| InChIKey | XONNZQRHMVHLNV-UHFFFAOYSA-N |
| SMILES | Nc1cccc(C(=O)Nc2ccc3c(O)cc(S(=O)(=O)O)cc3c2)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| m-Aminobenzoyl J Acid |
| EINECS 204-256-6 |
| 7-(3-amino-benzoylamino)-4-hydroxy-naphthalene-2-sulfonic acid |
| 2-Naphthalenesulfonic acid,7-[(3-aminobenzoyl)amino]-4-hydroxy |
| 6-(3-Amino-benzamino)-naphthol-(1)-sulfonsaeure-(3) |
| 7-(3-Amino-benzoylamino)-4-hydroxy-naphthalin-2-sulfonsaeure |