2-dimethoxyphosphoryl-1-phenylethanone structure
|
Common Name | 2-dimethoxyphosphoryl-1-phenylethanone | ||
|---|---|---|---|---|
| CAS Number | 1015-28-7 | Molecular Weight | 228.18200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-dimethoxyphosphoryl-1-phenylethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H13O4P |
|---|---|
| Molecular Weight | 228.18200 |
| Exact Mass | 228.05500 |
| PSA | 62.41000 |
| LogP | 2.35520 |
| InChIKey | MBYFZYKLKDLPEU-UHFFFAOYSA-N |
| SMILES | COP(=O)(CC(=O)c1ccccc1)OC |
| HS Code | 2931900090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Dimethyl 2-oxo-2-phenylethylphosphonate |
| 2-(dimethoxyphosphinyl)acetophenone |
| Phenacylphosphonsaeure-dimethylester |
| dimethyl phenacylphosphonate |
| phenacyl phosphonate de dimethyle |
| (2-oxo-2-phenylethyl)phosphonic acid dimethyl ester |
| dimethyl (benzoylmethyl)phosphonate |
| Phosphonic acid,(2-oxo-2-phenylethyl)-,dimethyl ester |