3-bromo-2,5,6-trimethoxybenzoic acid
Modify Date: 2025-08-26 21:58:31
3-bromo-2,5,6-trimethoxybenzoic acid structure
|
Common Name | 3-bromo-2,5,6-trimethoxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 101460-22-4 | Molecular Weight | 291.09500 | |
| Density | 1.53g/cm3 | Boiling Point | 380.2ºC at 760 mmHg | |
| Molecular Formula | C10H11BrO5 | Melting Point | 96ºC | |
| MSDS | N/A | Flash Point | 183.7ºC | |
| Name | 3-bromo-2,5,6-trimethoxybenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.53g/cm3 |
|---|---|
| Boiling Point | 380.2ºC at 760 mmHg |
| Melting Point | 96ºC |
| Molecular Formula | C10H11BrO5 |
| Molecular Weight | 291.09500 |
| Flash Point | 183.7ºC |
| Exact Mass | 289.97900 |
| PSA | 64.99000 |
| LogP | 2.17310 |
| Vapour Pressure | 1.85E-06mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | YHDRAWVCUZZYCU-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)c(OC)c(C(=O)O)c1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2918990090 |
|
~%
3-bromo-2,5,6-t... CAS#:101460-22-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 4 p. 1155 - 1163 |
|
~%
3-bromo-2,5,6-t... CAS#:101460-22-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 33, # 4 p. 1155 - 1163 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-Bromo-2,5,6-trimethoxybenzoic acid |
| 3-Bromo-2,5,6-trimethoxybenzoicacid |
| 5-bromo-2,3,6-trimethoxybenzoic acid |
| YHDRAWVCUZZYCU-UHFFFAOYSA |