N-(5-(p-Aminophenoxy)pentyl)-2,2-dichloroacetamide
Modify Date: 2025-11-13 06:15:06
N-(5-(p-Aminophenoxy)pentyl)-2,2-dichloroacetamide structure
|
Common Name | N-(5-(p-Aminophenoxy)pentyl)-2,2-dichloroacetamide | ||
|---|---|---|---|---|
| CAS Number | 101264-04-4 | Molecular Weight | 305.20000 | |
| Density | 1.251g/cm3 | Boiling Point | 508.5ºC at 760mmHg | |
| Molecular Formula | C13H18Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.3ºC | |
| Name | N-[5-(4-Aminophenoxy)pentyl]-2,2-dichloroacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.251g/cm3 |
|---|---|
| Boiling Point | 508.5ºC at 760mmHg |
| Molecular Formula | C13H18Cl2N2O2 |
| Molecular Weight | 305.20000 |
| Flash Point | 261.3ºC |
| Exact Mass | 304.07500 |
| PSA | 67.84000 |
| LogP | 4.15930 |
| Vapour Pressure | 1.85E-10mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | CMXVDRAADGZQKF-UHFFFAOYSA-N |
| SMILES | Nc1ccc(OCCCCCNC(=O)C(Cl)Cl)cc1 |
|
~%
N-(5-(p-Aminoph... CAS#:101264-04-4 |
| Literature: Ashley et al. Journal of the Chemical Society, 1959 , p. 3880,3882 |
|
~%
N-(5-(p-Aminoph... CAS#:101264-04-4 |
| Literature: Kidd,D.A.A.; Wright,D.E. Journal of the Chemical Society, 1962 , p. 1420 - 1427 |
|
~%
N-(5-(p-Aminoph... CAS#:101264-04-4 |
| Literature: Ashley et al. Journal of the Chemical Society, 1959 , p. 3880,3882 |
![4-[(5-Aminopentyl)oxy]aniline structure](https://www.chemsrc.com/extcaspic/191/91215-95-1.png)
| Dichlor-essigsaeure-[5-(4-amino-phenoxy)-pentylamid] |
| N-(5-(p-Aminophenoxy)pentyl)-2,2-dichloroacetamide |
| M &M B 4253 |
| ACETAMIDE,N-(5-(p-AMINOPHENOXY)PENTYL)-2,2-DICHLORO |
| B 4253 |
| dichloro-acetic acid-[5-(4-amino-phenoxy)-pentylamide] |
| LS-8079 |