N-[5-(4-aminophenoxy)pentyl]-2-cyanoacetamide
Modify Date: 2025-09-19 22:24:44
![N-[5-(4-aminophenoxy)pentyl]-2-cyanoacetamide Structure](https://image.chemsrc.com/caspic/480/101116-78-3.png)
N-[5-(4-aminophenoxy)pentyl]-2-cyanoacetamide structure
|
Common Name | N-[5-(4-aminophenoxy)pentyl]-2-cyanoacetamide | ||
|---|---|---|---|---|
| CAS Number | 101116-78-3 | Molecular Weight | 261.32000 | |
| Density | 1.133g/cm3 | Boiling Point | 551.9ºC at 760 mmHg | |
| Molecular Formula | C14H19N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 287.6ºC | |
| Name | N-[5-(4-aminophenoxy)pentyl]-2-cyanoacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 551.9ºC at 760 mmHg |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32000 |
| Flash Point | 287.6ºC |
| Exact Mass | 261.14800 |
| PSA | 91.63000 |
| LogP | 3.26928 |
| Vapour Pressure | 3.17E-12mmHg at 25°C |
| Index of Refraction | 1.547 |
| InChIKey | FTQZWXKZHXMWQM-UHFFFAOYSA-N |
| SMILES | N#CCC(=O)NCCCCCOc1ccc(N)cc1 |
|
~%
N-[5-(4-aminoph... CAS#:101116-78-3 |
| Literature: Ashley et al. Journal of the Chemical Society, 1959 , p. 3880,3882 |
|
~%
N-[5-(4-aminoph... CAS#:101116-78-3 |
| Literature: Ashley et al. Journal of the Chemical Society, 1959 , p. 3880,3882 |
![4-[(5-Aminopentyl)oxy]aniline structure](https://www.chemsrc.com/extcaspic/191/91215-95-1.png)
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ACETAMIDE,N-(5-(p-AMINOPHENOXY)PENTYL)-2-CYANO |
| Cyan-essigsaeure-[5-(4-amino-phenoxy)-pentylamid] |
| cyano-acetic acid-[5-(4-amino-phenoxy)-pentylamide] |
| M B 4454 |
| N-(5-(p-Aminophenoxy)pentyl)-2-cyanoacetamide |
| B 4454 |
| LS-8078 |