PTZ-343
Modify Date: 2025-08-28 16:54:19
PTZ-343 structure
|
Common Name | PTZ-343 | ||
|---|---|---|---|---|
| CAS Number | 101199-38-6 | Molecular Weight | 343.396 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14NNaO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PTZ-343PTZ-343 is a potent enhancer of Luminol (HY-15922). PTZ-343 greatly increases the light output of the peroxidase-catalyzed luminol chemiluminescent oxidation reaction (>80%)[1][2]. |
| Name | Sodium 3-(10H-phenothiazin-10-yl)propane-1-sulfonate |
|---|---|
| Synonym | More Synonyms |
| Description | PTZ-343 is a potent enhancer of Luminol (HY-15922). PTZ-343 greatly increases the light output of the peroxidase-catalyzed luminol chemiluminescent oxidation reaction (>80%)[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | PTZ-343 behaves as electron transfer mediator, it reacts with HRP-II to release HRP and a enhance (PTZ-343) radical. The enhancer (PTZ-343) radical quickly oxidizes luminol anions to induce light emission[1]. |
| References |
| Molecular Formula | C15H14NNaO3S2 |
|---|---|
| Molecular Weight | 343.396 |
| Exact Mass | 343.031281 |
| PSA | 94.12000 |
| LogP | 4.37040 |
| InChIKey | VKGYKXFNSKEHED-UHFFFAOYSA-M |
| SMILES | O=S(=O)([O-])CCCN1c2ccccc2Sc2ccccc21.[Na+] |
| HS Code | 2934999090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 0 | |
CAS#:1120-71-4
CAS#:92-84-2
CAS#:109-64-8| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 10H-Phenothiazine-10-propanesulfonic acid, sodium salt (1:1) |
| Sodium 3-(10H-phenothiazin-10-yl)-1-propanesulfonate |
| sodium,3-phenothiazin-10-ylpropane-1-sulfonate |
| 10H-Phenothiazine-10-propanesulfonic acid,sodiumsalt(1:1) |
| PTZ-343 |
| 10H-Phenothiazine-10-propanesulfonicacid, sodium salt (1:1) |