(±)-N-Methylephedrone hydrochloride
Modify Date: 2025-08-25 21:36:52
(±)-N-Methylephedrone hydrochloride structure
|
Common Name | (±)-N-Methylephedrone hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 10105-90-5 | Molecular Weight | 213.704 | |
| Density | 0.995g/cm3 | Boiling Point | 256.6ºC at 760mmHg | |
| Molecular Formula | C11H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 84.9ºC | |
Use of (±)-N-Methylephedrone hydrochlorideMetamfepramone is a sympathomimetic agent metamfepramone and is widely used for the treatment of the common cold or hypotonic conditions. |
| Name | 2-(dimethylamino)-1-phenylpropan-1-one,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Density | 0.995g/cm3 |
|---|---|
| Boiling Point | 256.6ºC at 760mmHg |
| Molecular Formula | C11H16ClNO |
| Molecular Weight | 213.704 |
| Flash Point | 84.9ºC |
| Exact Mass | 213.092041 |
| PSA | 20.31000 |
| LogP | 2.62140 |
| Vapour Pressure | 0.0152mmHg at 25°C |
| InChIKey | APOWZIQNQJSLKG-UHFFFAOYSA-N |
| SMILES | CC(C(=O)c1ccccc1)N(C)C.Cl |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| (+-)-2-Dimethylamino-1-phenyl-propan-1-on,Hydrochlorid |
| 2-(Dimethylamino)-1-phenylpropan-1-one hydrochloride (1:1) |
| 2-(Dimethylamino)propiophenone HCl |
| (Dimethylamino)propiophenone hydrochloride |
| UNII:6Y816E97O1 |
| (+-)-2-dimethylamino-1-phenyl-propan-1-one,hydrochloride |
| dl-Metamfepramone hydrochloride |
| Effilone |
| 2-(Dimethylamino)-1-phenyl-1-propanone hydrochloride (1:1) |
| 2-(Dimethylamino)propiophenone hydrochloride |
| 2-Dimethylamino-1-phenyl-1-propanone hydrochloride |
| dl-N-Methylephedrone hydrochloride |
| Metamfepramone Hydrochloride |
| EINECS 233-289-9 |
| Dimethcathinone hydrochloride |
| 1-Propanone, 2-(dimethylamino)-1-phenyl-, hydrochloride (1:1) |
| Dimethylaminoethylphenylketone hydrochloride |