a,a-Dimethylphenethyl butyrate structure
|
Common Name | a,a-Dimethylphenethyl butyrate | ||
|---|---|---|---|---|
| CAS Number | 10094-34-5 | Molecular Weight | 220.307 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 293.8±9.0 °C at 760 mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 106.1±17.1 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 1,1-Dimethyl-2-phenylethyl butyrate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 293.8±9.0 °C at 760 mmHg |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.307 |
| Flash Point | 106.1±17.1 °C |
| Exact Mass | 220.146332 |
| PSA | 26.30000 |
| LogP | 4.06 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.493 |
| InChIKey | SHSGYHAHMQLYRB-UHFFFAOYSA-N |
| SMILES | CCCC(=O)OC(C)(C)Cc1ccccc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H317 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face respirator (US);Gloves;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R38 |
| Safety Phrases | S36/37-S61 |
| RIDADR | UN3082 9/PG 3 |
| WGK Germany | 2 |
| RTECS | ET0130000 |
| Hazard Class | 9.0 |
| HS Code | 2915600000 |
| HS Code | 2915600000 |
|---|---|
| Summary | 2915600000 butanoic acids and pentanoic acids and their salts and esters VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Butanoic acid, 1,1-dimethyl-2-phenylethyl ester |
| MFCD00027132 |
| Butyric acid, α,α-dimethylphenethyl ester |
| a,a-Dimethylphenethyl butyrate |
| (2-methyl-1-phenylpropan-2-yl) butanoate |
| α,α-Dimethylphenethyl butyrate |
| 2-Methyl-1-phenyl-2-propanyl butyrate |
| 2-methyl-1-phenylpropan-2-yl butanoate |
| 2-Methyl-1-phenylpropan-2-yl butyrate |
| EINECS 233-221-8 |