(5-chloro-1-benzofuran-2-yl)-(4-hydroxyphenyl)methanone
Modify Date: 2025-09-28 22:47:27
(5-chloro-1-benzofuran-2-yl)-(4-hydroxyphenyl)methanone structure
|
Common Name | (5-chloro-1-benzofuran-2-yl)-(4-hydroxyphenyl)methanone | ||
|---|---|---|---|---|
| CAS Number | 100914-72-5 | Molecular Weight | 272.68300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (5-chloro-1-benzofuran-2-yl)-(4-hydroxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H9ClO3 |
|---|---|
| Molecular Weight | 272.68300 |
| Exact Mass | 272.02400 |
| PSA | 50.44000 |
| LogP | 4.02280 |
| InChIKey | DFGMTGTTWQLBHH-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(O)cc1)c1cc2cc(Cl)ccc2o1 |
|
~%
(5-chloro-1-ben... CAS#:100914-72-5 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1957 , p. 2593,2596 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Methanone,(5-chloro-2-benzofuranyl)(4-hydroxyphenyl) |
| (5-chloro-benzofuran-2-yl)-(4-hydroxy-phenyl)-ketone |
| (5-Chlor-benzofuran-2-yl)-(4-hydroxy-phenyl)-keton |