Cyclohexanecarbamic acid 1,1-bis(p-fluorophenyl)-2-propynyl ester structure
|
Common Name | Cyclohexanecarbamic acid 1,1-bis(p-fluorophenyl)-2-propynyl ester | ||
|---|---|---|---|---|
| CAS Number | 10087-77-1 | Molecular Weight | 369.40400 | |
| Density | 1.22g/cm3 | Boiling Point | 474.2ºC at 760 mmHg | |
| Molecular Formula | C22H21F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 240.6ºC | |
| Name | 1,1-bis(4-fluorophenyl)prop-2-ynyl N-cyclohexylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.22g/cm3 |
|---|---|
| Boiling Point | 474.2ºC at 760 mmHg |
| Molecular Formula | C22H21F2NO2 |
| Molecular Weight | 369.40400 |
| Flash Point | 240.6ºC |
| Exact Mass | 369.15400 |
| PSA | 41.82000 |
| LogP | 5.10490 |
| Vapour Pressure | 3.68E-09mmHg at 25°C |
| Index of Refraction | 1.574 |
| InChIKey | DGBAMTYZPLYMAR-UHFFFAOYSA-N |
| SMILES | C#CC(OC(=O)NC1CCCCC1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
Cyclohexanecarb... CAS#:10087-77-1 |
| Literature: Dillard,R.D. et al. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 40 - 44 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Cyclohexyl-carbamidsaeure-<1,1-bis-(4-fluor-phenyl)-propin-(2)-ylester> |
| 1,1-bis(4-fluorophenyl)prop-2-yn-1-yl cyclohexylcarbamate |
| 1,1-Bis(p-fluorophenyl)-2-propynyl-N-cyclohexylcarbamate |
| Cyclohexanecarbamic acid,1,1-bis(p-fluorophenyl)-2-propynyl ester |