(S)-tert-butyl 3-formylpiperidine-1-carboxylate structure
|
Common Name | (S)-tert-butyl 3-formylpiperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1008562-87-5 | Molecular Weight | 213.273 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 295.4±33.0 °C at 760 mmHg | |
| Molecular Formula | C11H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 132.5±25.4 °C | |
| Name | (S)-3-formyl-piperidine-1-carboxylic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 295.4±33.0 °C at 760 mmHg |
| Molecular Formula | C11H19NO3 |
| Molecular Weight | 213.273 |
| Flash Point | 132.5±25.4 °C |
| Exact Mass | 213.136490 |
| PSA | 46.61000 |
| LogP | 1.22 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | CTVHINDANRPFIL-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C=O)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933399090 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (s)-tert-butyl 3-formylpiperidine-1-carboxylate |
| (s)-1-boc-3-piperidinecarboxaldehyde |
| (s)-tert-butyl 3-formylpiperidine 1-carboxylate |