Bis[4-(2-phenyl-2-propyl)phenyl]amine structure
|
Common Name | Bis[4-(2-phenyl-2-propyl)phenyl]amine | ||
|---|---|---|---|---|
| CAS Number | 10081-67-1 | Molecular Weight | 405.574 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 535.2±39.0 °C at 760 mmHg | |
| Molecular Formula | C30H31N | Melting Point | 100°C | |
| MSDS | USA | Flash Point | 292.0±22.5 °C | |
| Name | Naugard 445 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 535.2±39.0 °C at 760 mmHg |
| Melting Point | 100°C |
| Molecular Formula | C30H31N |
| Molecular Weight | 405.574 |
| Flash Point | 292.0±22.5 °C |
| Exact Mass | 405.245636 |
| PSA | 12.03000 |
| LogP | 8.34 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.607 |
| InChIKey | UJAWGGOCYUPCPS-UHFFFAOYSA-N |
| SMILES | CC(C)(c1ccccc1)c1ccc(Nc2ccc(C(C)(C)c3ccccc3)cc2)cc1 |
| Risk Phrases | R36/37/38 |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2921499090 |
| HS Code | 2921499090 |
|---|---|
| Summary | 2921499090 other aromatic monoamines and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-(2-phenylpropan-2-yl)-n-[4-(2-phenylpropan-2-yl)phenyl]aniline |
| Benzenamine, 4-(1-methyl-1-phenylethyl)-N-(4-(1-methyl-1-phenylethyl)phenyl)- |
| Bis[4-(2-phenyl-2-propyl)phenyl]amine |
| Benzenamine, 4-(1-methyl-1-phenylethyl)-N-[4-(1-methyl-1-phenylethyl)phenyl]- |
| 4,4'-bis(alpha,alpha-Dimethylbenzyl)diphenylamine |
| MFCD00337918 |
| 4-(1-Methyl-1-phenylethyl)-N-(4-(1-methyl-1-phenylethyl)phenyl)aniline |
| 4,4'-Bis(α,α-dimethylbenzyl)diphenylamine |
| 4-(2-Phenyl-2-propanyl)-N-[4-(2-phenyl-2-propanyl)phenyl]aniline |
| EINECS 233-215-5 |