carbofuran d3 structure
|
Common Name | carbofuran d3 | ||
|---|---|---|---|---|
| CAS Number | 1007459-98-4 | Molecular Weight | 224.271 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 313.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H12D3NO3 | Melting Point | 150-1530C | |
| MSDS | Chinese USA | Flash Point | 143.3±27.9 °C | |
| Symbol |
GHS06, GHS09 |
Signal Word | Danger | |
| Name | (2,2-dimethyl-3H-1-benzofuran-7-yl) N-(trideuteriomethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 313.3±42.0 °C at 760 mmHg |
| Melting Point | 150-1530C |
| Molecular Formula | C12H12D3NO3 |
| Molecular Weight | 224.271 |
| Flash Point | 143.3±27.9 °C |
| Exact Mass | 224.124023 |
| PSA | 51.05000 |
| LogP | 1.76 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.526 |
| InChIKey | DUEPRVBVGDRKAG-HPRDVNIFSA-N |
| SMILES | CNC(=O)Oc1cccc2c1OC(C)(C)C2 |
| Storage condition | Refrigerator |
| Symbol |
GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H330-H410 |
| Precautionary Statements | Missing Phrase - N15.00950417-P260-P304 + P340 + P310-P403 + P233 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T+,N |
| Risk Phrases | 26/28-50/53 |
| Safety Phrases | 36/37-45-60-61 |
| RIDADR | UN2811 - class 6.1 - PG 1 - MP - RQ - Toxic solids, organic, n.o.s. HI: all |
|
Polar organic chemical integrative samplers for pesticides monitoring: impacts of field exposure conditions.
Sci. Total Environ. 488-489 , 188-96, (2014) This study focuses on how Polar Organic Chemical Integrative Samplers (POCIS) work in real environmental conditions. A selection of 23 polar pesticides and 8 metabolites were investigated by exposure ... |
| Carbofuran-d3 |
| 2,3-Dihydro-2,2-dimethyl-7-benzofuranol N-methylcarbamate-d3 |
| Furadan-d3 |
| Carbamic acid, N-methyl-d-, 2,3-dihydro-2,2-dimethyl-7-benzofuranyl ester |
| 2,2-Dimethyl-2,3-dihydro-1-benzofuran-7-yl (H)methylcarbamate |