Abz-Ala-Gly-Leu-Ala-p-nitrobenzylamide
Modify Date: 2025-08-31 17:28:01
Abz-Ala-Gly-Leu-Ala-p-nitrobenzylamide structure
|
Common Name | Abz-Ala-Gly-Leu-Ala-p-nitrobenzylamide | ||
|---|---|---|---|---|
| CAS Number | 100307-95-7 | Molecular Weight | 583.64 | |
| Density | 1.284g/cm3 | Boiling Point | 937.5ºC at 760 mmHg | |
| Molecular Formula | C28H37N7O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 520.8ºC | |
Use of Abz-Ala-Gly-Leu-Ala-p-nitrobenzylamideAbz-AGLA-Nba is a fluorogenic substrate for the determination of protease activity. Abz-AGLA-Nba is hydrolyzed to release aminoacyl benzimide (Abz-AGLA) and 2-naphthylaminoacyl (Nba). The product Abz-AGLA produced by this hydrolysis reaction is fluorescent under ultraviolet light and can emit a fluorescent signal[1]. |
| Name | 2-amino-N-[(2S)-1-[[2-[[(2S)-4-methyl-1-[[(2S)-2-[(4-nitrophenyl)methylamino]propanoyl]amino]-1-oxopentan-2-yl]amino]-2-oxoethyl]amino]-1-oxopropan-2-yl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | Abz-AGLA-Nba is a fluorogenic substrate for the determination of protease activity. Abz-AGLA-Nba is hydrolyzed to release aminoacyl benzimide (Abz-AGLA) and 2-naphthylaminoacyl (Nba). The product Abz-AGLA produced by this hydrolysis reaction is fluorescent under ultraviolet light and can emit a fluorescent signal[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.284g/cm3 |
|---|---|
| Boiling Point | 937.5ºC at 760 mmHg |
| Molecular Formula | C28H37N7O7 |
| Molecular Weight | 583.64 |
| Flash Point | 520.8ºC |
| Exact Mass | 583.27500 |
| PSA | 233.01000 |
| LogP | 5.17060 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.595 |
| InChIKey | KAGLSIMCIJOPKS-BSRJHKFKSA-N |
| SMILES | CC(C)CC(NC(=O)CNC(=O)C(C)NC(=O)c1ccccc1N)C(=O)NC(=O)C(C)NCc1ccc([N+](=O)[O-])cc1 |
| Aaglan |
| Abz-ala-gly-leu-ala-nba |
| 2-Aminobenzoylalanyl-glycyl-leucyl-alanyl-4-nitrobenzylamide |
| 2-Aminobenzoyl-ala-gly-leu-ala-4-nitrobenzylamide |
| L-Alaninamide,N-(2-aminobenzoyl)-L-alanylglycyl-L-leucyl-N-((4-nitrophenyl)methyl)-,(6aS-(6aalpha,7alpha,8beta,9aalpha)) |