CK-37
Modify Date: 2025-08-26 11:24:01
CK-37 structure
|
Common Name | CK-37 | ||
|---|---|---|---|---|
| CAS Number | 1001478-90-5 | Molecular Weight | 366.48000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H22N4OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CK-37A potent, specific, competitive inhibitor of choline kinase-α (Chok-α) by targeting the choline binding site; significantly increases LC3II expression in MCF-7 and MCF-7/TAM cells, increases the size and number of autophagosome, causes MCF-7 and MCF-7/TAM |
| Name | N-(3,5-dimethylphenyl)-2-[[5-(4-ethylphenyl)-2H-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|
| Molecular Formula | C20H22N4OS |
|---|---|
| Molecular Weight | 366.48000 |
| Exact Mass | 366.15100 |
| PSA | 95.97000 |
| LogP | 4.45470 |
| InChIKey | PSJVIOBOAOSNIY-UHFFFAOYSA-N |
| SMILES | CCc1ccc(-c2nc(SCC(=O)Nc3cc(C)cc(C)c3)n[nH]2)cc1 |