97070-73-0
97070-73-0 structure
- Name: (R)-(+)-3-METHYLSUCCINICACID1-MONOMETHYLESTER
- Chemical Name: (2R)-2-hydroxy-2-(4-methoxyphenyl)acetonitrile
- CAS Number: 97070-73-0
- Molecular Formula: C9H9NO2
- Molecular Weight: 163.17300
- Create Date: 2018-12-18 15:26:32
- Modify Date: 2024-01-10 10:40:13
| Name | (2R)-2-hydroxy-2-(4-methoxyphenyl)acetonitrile |
|---|---|
| Synonyms |
(R)-(+)-4-Methoxymandelonitrile
(2R)-2-hydroxy-2-(4-methoxyphenyl)ethanenitrile (R)-2-hydroxy-p-methoxyphenylacetonitrile MFCD01321258 (R)-(+)-2-hydroxy-2-(4-methoxyphenyl)acetonitrile InChI=1/C9H9NO2/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5,9,11H,1H |
| Density | 1.183g/cm3 |
|---|---|
| Boiling Point | 334.4ºC at 760mmHg |
| Melting Point | 84-87ºC(lit.) |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.17300 |
| Flash Point | 156.1ºC |
| Exact Mass | 163.06300 |
| PSA | 53.25000 |
| LogP | 1.25218 |
| Index of Refraction | 1.55 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H315-H319-H332-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 20/21/22-36/37/38 |
| Safety Phrases | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2926909090 |
| Precursor 10 | |
|---|---|
| DownStream 1 | |
![(R)-(+)-α-[(trimethylsilyl)oxy]-4-methoxybenzeneacetonotrile structure](https://www.chemsrc.com/caspic/411/120390-74-1.png)
![(R)-(+)-α-[(tert-butyldimethylsilyl)oxy]-α-(4-methoxyphenyl)acetonitrile structure](https://www.chemsrc.com/caspic/335/120390-76-3.png)
![α-[(trimethylsilyl)oxy]-α-(p-methoxyphenyl)acetonitrile structure](https://www.chemsrc.com/caspic/344/66985-48-6.png)
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |