Name | (2R)-2-hydroxy-2-(4-methoxyphenyl)acetonitrile |
---|---|
Synonyms |
(R)-(+)-4-Methoxymandelonitrile
(2R)-2-hydroxy-2-(4-methoxyphenyl)ethanenitrile (R)-2-hydroxy-p-methoxyphenylacetonitrile MFCD01321258 (R)-(+)-2-hydroxy-2-(4-methoxyphenyl)acetonitrile InChI=1/C9H9NO2/c1-12-8-4-2-7(3-5-8)9(11)6-10/h2-5,9,11H,1H |
Density | 1.183g/cm3 |
---|---|
Boiling Point | 334.4ºC at 760mmHg |
Melting Point | 84-87ºC(lit.) |
Molecular Formula | C9H9NO2 |
Molecular Weight | 163.17300 |
Flash Point | 156.1ºC |
Exact Mass | 163.06300 |
PSA | 53.25000 |
LogP | 1.25218 |
Index of Refraction | 1.55 |
Symbol |
![]() GHS07 |
---|---|
Signal Word | Warning |
Hazard Statements | H302-H312-H315-H319-H332-H335 |
Precautionary Statements | P261-P280-P305 + P351 + P338 |
Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
Hazard Codes | Xn: Harmful; |
Risk Phrases | 20/21/22-36/37/38 |
Safety Phrases | 26-37/39 |
RIDADR | NONH for all modes of transport |
HS Code | 2926909090 |
Precursor 10 | |
---|---|
DownStream 1 | |
HS Code | 2926909090 |
---|---|
Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |