| Name | 3-bromo-5-methoxy-4-(methoxymethoxy)benzaldehyde |
|---|---|
| Synonyms |
OZBJWLXWNBWPSW-UHFFFAOYSA
5-Brom-methoxymethyl-vanillin 5-Bromo-3-methoxy-4-(methoxymethoxy)benzene-1-carboxaldehyde Benzaldehyde,3-bromo-5-methoxy-4-(methoxymethoxy) InChI=1/C10H11BrO4/c1-13-6-15-10-8(11)3-7(5-12)4-9(10)14-2/h3-5H,6H2,1-2H3 |
| Molecular Formula | C10H11BrO4 |
|---|---|
| Molecular Weight | 275.09600 |
| Exact Mass | 273.98400 |
| PSA | 44.76000 |
| LogP | 2.25290 |
| HS Code | 2913000090 |
|---|
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |