| Name | 2-chloro-N-(3-nitrophenyl)benzamide |
|---|---|
| Synonyms |
Benzamide,N-(3-nitrophenyl)-2-chloro
Benzanilide,2-chloro-3'-nitro |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 348.7ºC at 760mmHg |
| Molecular Formula | C13H9ClN2O3 |
| Molecular Weight | 276.67500 |
| Flash Point | 164.7ºC |
| Exact Mass | 276.03000 |
| PSA | 74.92000 |
| LogP | 4.09670 |
| Index of Refraction | 1.676 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |