90665-30-8
90665-30-8 structure
- Name: Benzamide, 2-chloro-N-(3-nitrophenyl)-
- Chemical Name: 2-chloro-N-(3-nitrophenyl)benzamide
- CAS Number: 90665-30-8
- Molecular Formula: C13H9ClN2O3
- Molecular Weight: 276.67500
- Create Date: 2016-01-19 22:30:02
- Modify Date: 2024-04-02 12:11:23
| Name | 2-chloro-N-(3-nitrophenyl)benzamide |
|---|---|
| Synonyms |
Benzamide,N-(3-nitrophenyl)-2-chloro
Benzanilide,2-chloro-3'-nitro |
| Density | 1.44g/cm3 |
|---|---|
| Boiling Point | 348.7ºC at 760mmHg |
| Molecular Formula | C13H9ClN2O3 |
| Molecular Weight | 276.67500 |
| Flash Point | 164.7ºC |
| Exact Mass | 276.03000 |
| PSA | 74.92000 |
| LogP | 4.09670 |
| Index of Refraction | 1.676 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |