40335-00-0
40335-00-0 structure
- Name: Yu Borylation Ligand
- Chemical Name: 2,4-dimethoxyquinoline
- CAS Number: 40335-00-0
- Molecular Formula: C11H11NO2
- Molecular Weight: 189.21100
- Create Date: 2016-08-13 04:49:34
- Modify Date: 2025-08-28 15:00:33
| Name | 2,4-dimethoxyquinoline |
|---|---|
| Synonyms |
2,4-dimethoxyquinolone
quinoline,2,4-dimethoxy 2,4-Dimethoxy-chinolin InChI=1/C11H11NO2/c1-13-10-7-11(14-2)12-9-6-4-3-5-8(9)10/h3-7H,1-2H 2,4-dimethoxy-quinoline |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 272.9ºC at 760 mmHg |
| Molecular Formula | C11H11NO2 |
| Molecular Weight | 189.21100 |
| Flash Point | 100ºC |
| Exact Mass | 189.07900 |
| PSA | 31.35000 |
| LogP | 2.25200 |
| Index of Refraction | 1.589 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P280-P301 + P312 + P330-P304 + P340 + P312-P305 + P351 + P338-P337 + P313 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933499090 |
| Precursor 7 | |
|---|---|
| DownStream 5 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |