4042-67-5
4042-67-5 structure
- Name: bis(4-iodophenyl)phosphinic acid
- Chemical Name: bis(4-iodophenyl)phosphinic acid
- CAS Number: 4042-67-5
- Molecular Formula: C12H9I2O2P
- Molecular Weight: 469.98100
- Create Date: 2017-12-20 01:44:15
- Modify Date: 2024-01-10 19:47:39
| Name | bis(4-iodophenyl)phosphinic acid |
|---|---|
| Synonyms | Bis-<4-iod-phenyl>-phosphinsaeure |
| Density | 2.2g/cm3 |
|---|---|
| Boiling Point | 543.5ºC at 760 mmHg |
| Molecular Formula | C12H9I2O2P |
| Molecular Weight | 469.98100 |
| Flash Point | 282.5ºC |
| Exact Mass | 469.84300 |
| PSA | 47.11000 |
| LogP | 3.11700 |
| Vapour Pressure | 1.21E-12mmHg at 25°C |
| Index of Refraction | 1.736 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |