| Name | 3-Chloro-4-fluoroacetanilide |
|---|---|
| Synonyms |
Acetamide, N-(3-chloro-4-fluorophenyl)-
MFCD00018095 N-(3-Chloro-4-fluorophenyl)acetamide |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 329.4±32.0 °C at 760 mmHg |
| Melting Point | 116-119ºC |
| Molecular Formula | C8H7ClFNO |
| Molecular Weight | 187.599 |
| Flash Point | 153.0±25.1 °C |
| Exact Mass | 187.020020 |
| PSA | 29.10000 |
| LogP | 2.30 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.569 |
|
~%
877-90-7 |
| Literature: US4826982 A1, ; |
|
~94%
877-90-7 |
| Literature: El-Abadelah, Mustafa M.; Nazer, Musa Z.; El-Abadla, Naser S.; Meier, Herbert Heterocycles, 1995 , vol. 41, # 10 p. 2203 - 2220 |
|
~%
877-90-7 |
| Literature: Heterocyclic Communications, , vol. 17, # 3-4 p. 111 - 119 |
| Precursor 3 | |
|---|---|
| DownStream 2 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |