| Name |
N-[4-({[4,6-bis(dimethylamino)-1,3,5-triazin-2-yl]methyl}sulfamoyl)phenyl]acetamide
|
| Molecular Formula |
C16H23N7O3S
|
| Molecular Weight |
393.5
|
| Smiles |
CC(=O)Nc1ccc(S(=O)(=O)NCc2nc(N(C)C)nc(N(C)C)n2)cc1
|
CC(=O)Nc1ccc(S(=O)(=O)NCc2nc(N(C)C)nc(N(C)C)n2)cc1
The content on this webpage is sourced from various professional data sources. If you have any questions or concerns regarding the content, please feel free to contact service1@chemsrc.com.