N-(2-nitro-4-propylphenyl)acetamide structure
|
Common Name | N-(2-nitro-4-propylphenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 99841-36-8 | Molecular Weight | 222.24000 | |
| Density | 1.209g/cm3 | Boiling Point | 416.6ºC at 760 mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | 65-67ºC | |
| MSDS | N/A | Flash Point | 205.8ºC | |
| Name | N-(2-nitro-4-propylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.209g/cm3 |
|---|---|
| Boiling Point | 416.6ºC at 760 mmHg |
| Melting Point | 65-67ºC |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24000 |
| Flash Point | 205.8ºC |
| Exact Mass | 222.10000 |
| PSA | 74.92000 |
| LogP | 3.10190 |
| Index of Refraction | 1.581 |
| InChIKey | SXFNOCQYZBBQRC-UHFFFAOYSA-N |
| SMILES | CCCc1ccc(NC(C)=O)c([N+](=O)[O-])c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2924299090 |
|
~%
N-(2-nitro-4-pr... CAS#:99841-36-8 |
| Literature: Baddeley; Kenner Journal of the Chemical Society, 1935 , p. 303,307 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| acetic acid-(2-nitro-4-propyl-anilide) |
| Essigsaeure-(2-nitro-4-propyl-anilid) |
| 2'-Nitro-4'-propylacetanilide |