5,7-dimethyl-1,2,4-triazolo[1,5-a]pyrimidine-2-sulphonyl chloride
Modify Date: 2025-08-25 17:51:20
![5,7-dimethyl-1,2,4-triazolo[1,5-a]pyrimidine-2-sulphonyl chloride Structure](https://image.chemsrc.com/caspic/473/98169-74-5.png)
5,7-dimethyl-1,2,4-triazolo[1,5-a]pyrimidine-2-sulphonyl chloride structure
|
Common Name | 5,7-dimethyl-1,2,4-triazolo[1,5-a]pyrimidine-2-sulphonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 98169-74-5 | Molecular Weight | 246.67400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H7ClN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5,7-dimethyl-1,2,4-triazolo[1,5-a]pyrimidine-2-sulphonyl chloride |
|---|
| Molecular Formula | C7H7ClN4O2S |
|---|---|
| Molecular Weight | 246.67400 |
| Exact Mass | 245.99800 |
| PSA | 85.60000 |
| LogP | 1.74940 |
| InChIKey | RRSWSFWNULDHMF-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n2nc(S(=O)(=O)Cl)nc2n1 |
| HS Code | 2933990090 |
|---|
|
~75%
5,7-dimethyl-1,... CAS#:98169-74-5 |
| Literature: The Dow Chemical Company Patent: US4818273 A1, 1989 ; |
![2-benzylsulfanyl-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine structure](https://image.chemsrc.com/caspic/326/51646-15-2.png)
| Precursor 1 | |
|---|---|
| DownStream 1 | |
![N-(2,6-dichlorophenyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide structure](https://image.chemsrc.com/caspic/043/98937-00-9.png)
CAS#:98937-00-9| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |