N-(2,6-dichlorophenyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide structure
|
Common Name | N-(2,6-dichlorophenyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 98937-00-9 | Molecular Weight | 372.23000 | |
| Density | 1.66g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H11Cl2N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2,6-dichlorophenyl)-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine-2-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.66g/cm3 |
|---|---|
| Molecular Formula | C13H11Cl2N5O2S |
| Molecular Weight | 372.23000 |
| Exact Mass | 371.00100 |
| PSA | 97.63000 |
| LogP | 4.00250 |
| Index of Refraction | 1.735 |
| InChIKey | RZWWGOCLMSGROE-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n2nc(S(=O)(=O)Nc3c(Cl)cccc3Cl)nc2n1 |
|
~79%
N-(2,6-dichloro... CAS#:98937-00-9 |
| Literature: The Dow Chemical Company Patent: US4910306 A1, 1990 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HMS2662D20 |
| N-(2,6-dichlorphenyl)-5.7-dimethyl[1,2,4]triazolo [1.5-A]pyrimidin-2-sulfonamide |
| 5,7-Dimethyl-N-(2,6-dichlorophenyl)-1,2,4-triazolo[1,5-a]pyrimidine-2-sulfonamide |
| N-(2,6-di-chlorophenyl)-5,7-dimethyl-1,2,4-triazolo-[1,5-a]pyrimidine-2-sulfonamide |
| N-(2,6-DICHLOROPHENYL)-2,4-DIMETHYL-1,5,7,9-TETRAZABICYCLO[4.3.0]NONA-2,4,6,8-TETRAENE-8-SULFONAMIDE |