5-O-[3-[benzyl(methyl)amino]-2,2-dimethylpropyl] 3-O-methyl 4-(2-fluoro-5-nitrophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate,hydrochloride structure
|
Common Name | 5-O-[3-[benzyl(methyl)amino]-2,2-dimethylpropyl] 3-O-methyl 4-(2-fluoro-5-nitrophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 96515-74-1 | Molecular Weight | 576.05600 | |
| Density | N/A | Boiling Point | 619.1ºC at 760 mmHg | |
| Molecular Formula | C29H35ClFN3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.2ºC | |
| Name | 5-O-[3-[benzyl(methyl)amino]-2,2-dimethylpropyl] 3-O-methyl 4-(2-fluoro-5-nitrophenyl)-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 619.1ºC at 760 mmHg |
|---|---|
| Molecular Formula | C29H35ClFN3O6 |
| Molecular Weight | 576.05600 |
| Flash Point | 328.2ºC |
| Exact Mass | 575.22000 |
| PSA | 113.69000 |
| LogP | 6.49710 |
| InChIKey | OQHXRVQARZHYGQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCC(C)(C)CN(C)Cc2ccccc2)C1c1cc([N+](=O)[O-])ccc1F.Cl |
|
~%
5-O-[3-[benzyl(... CAS#:96515-74-1 |
| Literature: Kanno; Yamaguchi; Okamiya; Sunakawa; Takeshita; Naruchi Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 8 p. 2049 - 2054 |
|
~%
5-O-[3-[benzyl(... CAS#:96515-74-1 |
| Literature: Kanno; Yamaguchi; Okamiya; Sunakawa; Takeshita; Naruchi Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 8 p. 2049 - 2054 |
|
~%
5-O-[3-[benzyl(... CAS#:96515-74-1 |
| Literature: Kanno; Yamaguchi; Okamiya; Sunakawa; Takeshita; Naruchi Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 8 p. 2049 - 2054 |
|
~%
5-O-[3-[benzyl(... CAS#:96515-74-1 |
| Literature: Kanno; Yamaguchi; Okamiya; Sunakawa; Takeshita; Naruchi Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 8 p. 2049 - 2054 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-(Benzyl-methyl-amino)-1-(4-chlor-phenyl)-propan-1-on,Hydrochlorid |
| 3-(benzyl(methyl)amino)-1-(4-chlorophenyl)propan-1-one hydrochloride |
| Palonidipine hydrochloride |
| 3-(Benzylmethylamino)-2,2-dimethylpropyl methyl 4-(2-fluoro-5-nitrophenyl)-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate |