2-methyl-1,5-bis(4-nitrophenyl)penta-1,4-dien-3-one structure
|
Common Name | 2-methyl-1,5-bis(4-nitrophenyl)penta-1,4-dien-3-one | ||
|---|---|---|---|---|
| CAS Number | 919079-85-9 | Molecular Weight | 338.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-1,5-bis(4-nitrophenyl)penta-1,4-dien-3-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H14N2O5 |
|---|---|
| Molecular Weight | 338.31400 |
| Exact Mass | 338.09000 |
| PSA | 108.71000 |
| LogP | 5.23520 |
| InChIKey | NEWQRAXHTXEPDK-UHFFFAOYSA-N |
| SMILES | CC(=Cc1ccc([N+](=O)[O-])cc1)C(=O)C=Cc1ccc([N+](=O)[O-])cc1 |
|
~%
2-methyl-1,5-bi... CAS#:919079-85-9 |
| Literature: Ananthakrishna Nadar; Renuga Journal of the Indian Chemical Society, 2006 , vol. 83, # 12 p. 1219 - 1222 |
| 1,4-Pentadien-3-one,2-methyl-1,5-bis(4-nitrophenyl) |