1,4-dibromo-2,3-dibutoxynaphthalene structure
|
Common Name | 1,4-dibromo-2,3-dibutoxynaphthalene | ||
|---|---|---|---|---|
| CAS Number | 918332-78-2 | Molecular Weight | 430.17400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22Br2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-dibromo-2,3-dibutoxynaphthalene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H22Br2O2 |
|---|---|
| Molecular Weight | 430.17400 |
| Exact Mass | 427.99900 |
| PSA | 18.46000 |
| LogP | 6.72260 |
| InChIKey | WNDFIABXRGVGOQ-UHFFFAOYSA-N |
| SMILES | CCCCOc1c(OCCCC)c(Br)c2ccccc2c1Br |
|
~%
1,4-dibromo-2,3... CAS#:918332-78-2 |
| Literature: Huang, Hui; Miao, Qian; Kang, Yixiong; Huang, Xiaobo; Xu, Jinqian; Cheng, Yixiang Bulletin of the Chemical Society of Japan, 2008 , vol. 81, # 9 p. 1116 - 1124 |
| Naphthalene,1,4-dibromo-2,3-dibutoxy |