1-(carbamothioylamino)-3-(4-chlorophenyl)thiourea structure
|
Common Name | 1-(carbamothioylamino)-3-(4-chlorophenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 89981-53-3 | Molecular Weight | 260.76700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9ClN4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(carbamothioylamino)-3-(4-chlorophenyl)thiourea |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9ClN4S2 |
|---|---|
| Molecular Weight | 260.76700 |
| Exact Mass | 259.99600 |
| PSA | 137.87000 |
| LogP | 2.97050 |
| InChIKey | AJHFPDZALJKOMN-UHFFFAOYSA-N |
| SMILES | NC(=S)NNC(=S)Nc1ccc(Cl)cc1 |
|
~44%
1-(carbamothioy... CAS#:89981-53-3 |
| Literature: Singh, Anirudh P.; Singh, Rajendra; Verma, Vinay Kumar Heterocycles, 1988 , vol. 27, # 10 p. 2373 - 2380 |
|
~%
1-(carbamothioy... CAS#:89981-53-3 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1956 , p. 2160,2161 |
| N-Thioureido-N'-<4-chlor-phenyl>-thioharnstoff |
| 1-p-chlorophenyl-2,5-dithiohydrazodicarbonamide |
| hydrazine-N,N'-dicarbothioic acid amide 4-chloro-anilide |