1-(1H-benzimidazol-2-ylmethyl)-3-(4-chlorophenyl)thiourea
Modify Date: 2025-08-25 15:04:57
1-(1H-benzimidazol-2-ylmethyl)-3-(4-chlorophenyl)thiourea structure
|
Common Name | 1-(1H-benzimidazol-2-ylmethyl)-3-(4-chlorophenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 89334-46-3 | Molecular Weight | 316.80900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClN4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(1H-benzimidazol-2-ylmethyl)-3-(4-chlorophenyl)thiourea |
|---|
| Molecular Formula | C15H13ClN4S |
|---|---|
| Molecular Weight | 316.80900 |
| Exact Mass | 316.05500 |
| PSA | 91.87000 |
| LogP | 4.18720 |
| InChIKey | XGEQXMSEJYSHDL-UHFFFAOYSA-N |
| SMILES | S=C(NCc1nc2ccccc2[nH]1)Nc1ccc(Cl)cc1 |
|
~88%
1-(1H-benzimida... CAS#:89334-46-3 |
| Literature: Masoud, Georgina N.; Youssef, Amal M.; Abdel Khalek, Magdy M.; Abdel Wahab, Abeer E.; Labouta, Ibrahim M.; Hazzaa, Aly A. B. Medicinal Chemistry Research, 2013 , vol. 22, # 2 p. 707 - 725 |
|
~52%
1-(1H-benzimida... CAS#:89334-46-3 |
| Literature: Husain; Srivastava; Dua Journal of the Indian Chemical Society, 1983 , vol. 60, # 7 p. 665 - 667 |
![(1H-Benzo[d]imidazol-2-yl)methanamine structure](https://image.chemsrc.com/caspic/324/5805-57-2.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |