1-[4-[(4-acetylphenoxy)methoxy]phenyl]ethanone structure
|
Common Name | 1-[4-[(4-acetylphenoxy)methoxy]phenyl]ethanone | ||
|---|---|---|---|---|
| CAS Number | 88949-85-3 | Molecular Weight | 284.30700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-[(4-acetylphenoxy)methoxy]phenyl]ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H16O4 |
|---|---|
| Molecular Weight | 284.30700 |
| Exact Mass | 284.10500 |
| PSA | 52.60000 |
| LogP | 3.50710 |
| InChIKey | VMSKJIFMEMGPKC-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(OCOc2ccc(C(C)=O)cc2)cc1 |
|
~%
1-[4-[(4-acetyl... CAS#:88949-85-3 |
| Literature: Tani,H. et al. Bulletin of the Chemical Society of Japan, 1964 , vol. 37, p. 919 - 923 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Bis-(4-acetyl-phenoxy)-methan |
| Ethanone,1,1'-[methylenebis(oxy-4,1-phenylene)]bis |