2-(dibenzylamino)-1-(4-hydroxyphenyl)ethanone structure
|
Common Name | 2-(dibenzylamino)-1-(4-hydroxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 88693-95-2 | Molecular Weight | 331.40800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(dibenzylamino)-1-(4-hydroxyphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H21NO2 |
|---|---|
| Molecular Weight | 331.40800 |
| Exact Mass | 331.15700 |
| PSA | 40.54000 |
| LogP | 4.27730 |
| InChIKey | IVYXQLYXYHJMEO-UHFFFAOYSA-N |
| SMILES | O=C(CN(Cc1ccccc1)Cc1ccccc1)c1ccc(O)cc1 |
|
~%
2-(dibenzylamin... CAS#:88693-95-2 |
| Literature: Simonoff; Hartung Journal of the American Pharmaceutical Association (1912-1977), 1946 , vol. 35, p. 306,308 |
|
~%
2-(dibenzylamin... CAS#:88693-95-2 |
| Literature: Simonoff; Hartung Journal of the American Pharmaceutical Association (1912-1977), 1946 , vol. 35, p. 306,308 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Ethanone,2-[bis(phenylmethyl)amino]-1-(4-hydroxyphenyl) |
| 2-dibenzylamino-1-(4-hydroxy-phenyl)-ethanone |
| 2-Dibenzylamino-1-(4-hydroxy-phenyl)-aethanon |