2-(butylamino)-1-(4-hydroxyphenyl)ethanone,hydrochloride
Modify Date: 2025-09-21 22:32:04
2-(butylamino)-1-(4-hydroxyphenyl)ethanone,hydrochloride structure
|
Common Name | 2-(butylamino)-1-(4-hydroxyphenyl)ethanone,hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 28836-20-6 | Molecular Weight | 243.73000 | |
| Density | N/A | Boiling Point | 366.9ºC at 760mmHg | |
| Molecular Formula | C12H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.7ºC | |
| Name | 2-(butylamino)-1-(4-hydroxyphenyl)ethanone,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 366.9ºC at 760mmHg |
|---|---|
| Molecular Formula | C12H18ClNO2 |
| Molecular Weight | 243.73000 |
| Flash Point | 175.7ºC |
| Exact Mass | 243.10300 |
| PSA | 49.33000 |
| LogP | 3.15750 |
| Vapour Pressure | 6.74E-06mmHg at 25°C |
| InChIKey | CGKWVBXPIYSYAY-UHFFFAOYSA-N |
| SMILES | CCCCNCC(=O)c1ccc(O)cc1.Cl |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Butylsympathon |
| p-Oxy-butylamino-acetophenone |
| p-Hydroxyphenyl-n-butylaminomethylketone |