3-(chloromethyl)-2,6-dimethylchromen-4-one structure
|
Common Name | 3-(chloromethyl)-2,6-dimethylchromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 88214-15-7 | Molecular Weight | 222.66800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(chloromethyl)-2,6-dimethylchromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11ClO2 |
|---|---|
| Molecular Weight | 222.66800 |
| Exact Mass | 222.04500 |
| PSA | 30.21000 |
| LogP | 3.14860 |
| InChIKey | RAFPPJZNYDRUEB-UHFFFAOYSA-N |
| SMILES | Cc1ccc2oc(C)c(CCl)c(=O)c2c1 |
|
~%
3-(chloromethyl... CAS#:88214-15-7 |
| Literature: Dean, Francis M.; Al-Sattar, Mohammad; Smith, Dennis A. Journal of the Chemical Society, Chemical Communications, 1983 , # 9 p. 535 - 536 |
| 3-chloromethyl-2,6-dimethylchromone |