2,2,3,3,4,4,5,5-octafluoropentyl 2-fluoroprop-2-enoate
Modify Date: 2025-08-26 00:08:25
2,2,3,3,4,4,5,5-octafluoropentyl 2-fluoroprop-2-enoate structure
|
Common Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-fluoroprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 87910-92-7 | Molecular Weight | 304.11000 | |
| Density | 1.548 | Boiling Point | 70ºC | |
| Molecular Formula | C8H5F9O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 60.6ºC | |
| Name | 2,2,3,3,4,4,5,5-octafluoropentyl 2-fluoroprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.548 |
|---|---|
| Boiling Point | 70ºC |
| Molecular Formula | C8H5F9O2 |
| Molecular Weight | 304.11000 |
| Flash Point | 60.6ºC |
| Exact Mass | 304.01500 |
| PSA | 26.30000 |
| LogP | 3.18380 |
| Index of Refraction | 1.347 |
| InChIKey | PPQCLSSVNOGTKE-UHFFFAOYSA-N |
| SMILES | C=C(F)C(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2916190090 |
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 1H,1H,5H-Perfluoropentyl-2-fluoroacrylate |
| PC4972 |