1-N,1-N,1-N',1-N',3-pentamethyl-2,5-dihydrophosphol-1-ium-1,1-diamine
Modify Date: 2025-11-14 10:34:28
1-N,1-N,1-N',1-N',3-pentamethyl-2,5-dihydrophosphol-1-ium-1,1-diamine structure
|
Common Name | 1-N,1-N,1-N',1-N',3-pentamethyl-2,5-dihydrophosphol-1-ium-1,1-diamine | ||
|---|---|---|---|---|
| CAS Number | 87712-52-5 | Molecular Weight | 187.24200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H20N2P+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-N,1-N,1-N',1-N',3-pentamethyl-2,5-dihydrophosphol-1-ium-1,1-diamine |
|---|
| Molecular Formula | C9H20N2P+ |
|---|---|
| Molecular Weight | 187.24200 |
| Exact Mass | 187.13600 |
| PSA | 20.07000 |
| LogP | 1.91710 |
| InChIKey | RZNLDSQTFCHHJZ-UHFFFAOYSA-N |
| SMILES | CC1=CC[P+](N(C)C)(N(C)C)C1 |
|
~87%
1-N,1-N,1-N',1-... CAS#:87712-52-5 |
| Literature: SooHoo, Carlton K.; Baxter, S. G. Journal of the American Chemical Society, 1983 , vol. 105, # 25 p. 7443 - 7444 |
|
~%
1-N,1-N,1-N',1-... CAS#:87712-52-5 |
| Literature: SooHoo, Carlton K.; Baxter, S. G. Journal of the American Chemical Society, 1983 , vol. 105, # 25 p. 7443 - 7444 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |