2-methyl-4-(2-phenylpropan-2-yl)phenol structure
|
Common Name | 2-methyl-4-(2-phenylpropan-2-yl)phenol | ||
|---|---|---|---|---|
| CAS Number | 837-09-2 | Molecular Weight | 226.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-4-(2-phenylpropan-2-yl)phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H18O |
|---|---|
| Molecular Weight | 226.31400 |
| Exact Mass | 226.13600 |
| PSA | 20.23000 |
| LogP | 4.02650 |
| InChIKey | VWCDBDPQUBJQDU-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(C)(C)c2ccccc2)ccc1O |
|
~49%
2-methyl-4-(2-p... CAS#:837-09-2 |
| Literature: Liguori, Lucia; Bjorsvik, Hans-Rene; Fontana, Francesca; Bosco, Dino; Galimberti, Laura; Minisci, Francesco Journal of Organic Chemistry, 1999 , vol. 64, # 24 p. 8812 - 8815 |
|
~52%
2-methyl-4-(2-p... CAS#:837-09-2 |
| Literature: Rosevear, Judi; Wilshire, John F.K. Australian Journal of Chemistry, 1985 , vol. 38, # 8 p. 1163 - 1176 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-methyl-4-cumylphenol |