3-methyl-1,1-bis(2,4,6-trimethylphenyl)-2,5-dihydrogermole structure
|
Common Name | 3-methyl-1,1-bis(2,4,6-trimethylphenyl)-2,5-dihydrogermole | ||
|---|---|---|---|---|
| CAS Number | 822341-31-1 | Molecular Weight | 379.12400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H30Ge | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-1,1-bis(2,4,6-trimethylphenyl)-2,5-dihydrogermole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H30Ge |
|---|---|
| Molecular Weight | 379.12400 |
| Exact Mass | 380.15600 |
| LogP | 6.31110 |
| InChIKey | SOIAEDKYMXLRGV-UHFFFAOYSA-N |
| SMILES | CC1=CC[Ge](c2c(C)cc(C)cc2C)(c2c(C)cc(C)cc2C)C1 |
|
~97%
3-methyl-1,1-bi... CAS#:822341-31-1 |
| Literature: Leigh, William J.; Harrington, Cameron R.; Vargas-Baca, Ignacio Journal of the American Chemical Society, 2004 , vol. 126, # 49 p. 16105 - 16116 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1H-Germole,2,5-dihydro-3-methyl-1,1-bis(2,4,6-trimethylphenyl) |