2-[(2-amino-6-chloropurin-9-yl)methoxy]ethanol structure
|
Common Name | 2-[(2-amino-6-chloropurin-9-yl)methoxy]ethanol | ||
|---|---|---|---|---|
| CAS Number | 81777-49-3 | Molecular Weight | 243.65000 | |
| Density | 1.75g/cm3 | Boiling Point | 555.2ºC at 760 mmHg | |
| Molecular Formula | C8H10ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 289.6ºC | |
| Name | 2-[(2-amino-6-chloropurin-9-yl)methoxy]ethanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 555.2ºC at 760 mmHg |
| Molecular Formula | C8H10ClN5O2 |
| Molecular Weight | 243.65000 |
| Flash Point | 289.6ºC |
| Exact Mass | 243.05200 |
| PSA | 99.81000 |
| Index of Refraction | 1.74 |
| InChIKey | BSFGGUCAZGXDGK-UHFFFAOYSA-N |
| SMILES | Nc1nc(Cl)c2ncn(COCCO)c2n1 |
|
~84%
2-[(2-amino-6-c... CAS#:81777-49-3 |
| Literature: Robins; Hatfield Canadian Journal of Chemistry, 1982 , vol. 60, # 5 p. 547 - 553 |
|
~42%
2-[(2-amino-6-c... CAS#:81777-49-3 |
| Literature: Stimac; Kobe Synthesis, 1990 , # 6 p. 461 - 464 |
|
~%
2-[(2-amino-6-c... CAS#:81777-49-3 |
| Literature: Stimac; Kobe Synthesis, 1990 , # 6 p. 461 - 464 |
| 2-amino-6-chloro-9-<(2-hydroxyethoxy)methyl>-9H-purine |
| 2-[(2-amino-6-chloro-9h-purin-9-yl)methoxy]ethanol |
| 9-[(2-Hydroxyethoxy)methyl]-2-amino-6-chloropurine |
| 2-amino-6-chloro-9-<(2-hydroxyethoxy)methyl>purine |