4-(3,4-dichlorophenyl)-2-hydroxy-4-oxobutanoic acid structure
|
Common Name | 4-(3,4-dichlorophenyl)-2-hydroxy-4-oxobutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 81008-09-5 | Molecular Weight | 263.07400 | |
| Density | 1.543g/cm3 | Boiling Point | 510.3ºC at 760mmHg | |
| Molecular Formula | C10H8Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.4ºC | |
| Name | 4-(3,4-dichlorophenyl)-2-hydroxy-4-oxobutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.543g/cm3 |
|---|---|
| Boiling Point | 510.3ºC at 760mmHg |
| Molecular Formula | C10H8Cl2O4 |
| Molecular Weight | 263.07400 |
| Flash Point | 262.4ºC |
| Exact Mass | 261.98000 |
| PSA | 74.60000 |
| LogP | 2.01170 |
| Index of Refraction | 1.601 |
| InChIKey | OFKDXERWJCPSAE-UHFFFAOYSA-N |
| SMILES | O=C(CC(O)C(=O)O)c1ccc(Cl)c(Cl)c1 |
|
~37%
4-(3,4-dichloro... CAS#:81008-09-5 |
| Literature: Dorwald, Florencio Zaragoza; Andersen, Knud Erik; Sorensen, Jan Lindy Patent: US2004/19039 A1, 2004 ; Location in patent: Page/Page column 99 ; US 20040019039 A1 |
|
~52%
4-(3,4-dichloro... CAS#:81008-09-5 |
| Literature: Bianchi, Mario; Butti, Alina; Christidis, Yani; Perronnet, Jacques; Barzaghi, Fernando; et al. European Journal of Medicinal Chemistry, 1988 , vol. 23, p. 45 - 52 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-(3,4-dichlorophenyl)-2-hydroxy-4-oxobutyric acid |
| 2-hydroxy-4-(3',4'-dichlorophenyl)-4-oxo-butanoic acid |
| 4-(3,4-Dichlorophenyl)-4-oxo-2-hydroxybutanoic acid |
| 4-(3,4-dichlorophenyl)-4-oxo-2-hydroxybutyric acid |