6-hydroxy-4-methyl-2,3-dihydro-1H-naphtho[3,2-f]quinoxaline-7,12-dione structure
|
Common Name | 6-hydroxy-4-methyl-2,3-dihydro-1H-naphtho[3,2-f]quinoxaline-7,12-dione | ||
|---|---|---|---|---|
| CAS Number | 79928-91-9 | Molecular Weight | 294.30500 | |
| Density | 1.392g/cm3 | Boiling Point | 601.9ºC at 760 mmHg | |
| Molecular Formula | C17H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.8ºC | |
| Name | 6-hydroxy-4-methyl-2,3-dihydro-1H-naphtho[3,2-f]quinoxaline-7,12-dione |
|---|
| Density | 1.392g/cm3 |
|---|---|
| Boiling Point | 601.9ºC at 760 mmHg |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.30500 |
| Flash Point | 317.8ºC |
| Exact Mass | 294.10000 |
| PSA | 69.64000 |
| LogP | 2.23230 |
| Index of Refraction | 1.678 |
| InChIKey | APSKHHOZFBLIRP-UHFFFAOYSA-N |
| SMILES | CN1CCNc2c1cc(O)c1c2C(=O)c2ccccc2C1=O |
|
~30%
6-hydroxy-4-met... CAS#:79928-91-9 |
| Literature: Takei, Toshio; Matsuoka, Masaru; Kitao, Teijiro Bulletin of the Chemical Society of Japan, 1981 , vol. 54, # 9 p. 2735 - 2738 |
|
~%
6-hydroxy-4-met... CAS#:79928-91-9 |
| Literature: Takei, Toshio; Matsuoka, Masaru; Kitao, Teijiro Bulletin of the Chemical Society of Japan, 1981 , vol. 54, # 9 p. 2735 - 2738 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |