5-fluoro-dCTP
5-fluoro-dCTP structure
|
Common Name | 5-fluoro-dCTP | ||
|---|---|---|---|---|
| CAS Number | 79671-09-3 | Molecular Weight | 485.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15FN3O13P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-fluoro-dCTP5-fluoro-dCTP is a fluorinated pyrimidine dNTP that can be used as a substrate for the incorporation of fluorine modification into specific DNA sequences by primer extension (PEX) catalyzed by Pwo polymerase[1]. |
| Name | 5-fluoro-dCTP |
|---|
| Description | 5-fluoro-dCTP is a fluorinated pyrimidine dNTP that can be used as a substrate for the incorporation of fluorine modification into specific DNA sequences by primer extension (PEX) catalyzed by Pwo polymerase[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C9H15FN3O13P3 |
|---|---|
| Molecular Weight | 485.15 |
| InChIKey | YXBCZHAEVSTXFP-RRKCRQDMSA-N |
| SMILES | Nc1nc(=O)n(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)cc1F |