N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]formamide
Modify Date: 2025-09-11 17:27:52
![N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]formamide Structure](https://image.chemsrc.com/caspic/026/786-25-4.png)
N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]formamide structure
|
Common Name | N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]formamide | ||
|---|---|---|---|---|
| CAS Number | 786-25-4 | Molecular Weight | 283.32700 | |
| Density | 1.591g/cm3 | Boiling Point | 548.8ºC at 760 mmHg | |
| Molecular Formula | C10H9N3O3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.7ºC | |
| Name | N-[4-(1,3-thiazol-2-ylsulfamoyl)phenyl]formamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.591g/cm3 |
|---|---|
| Boiling Point | 548.8ºC at 760 mmHg |
| Molecular Formula | C10H9N3O3S2 |
| Molecular Weight | 283.32700 |
| Flash Point | 285.7ºC |
| Exact Mass | 283.00900 |
| PSA | 128.27000 |
| LogP | 3.31550 |
| Index of Refraction | 1.695 |
| InChIKey | XCTDPFHKIGVRLA-UHFFFAOYSA-N |
| SMILES | O=CNc1ccc(S(=O)(=O)Nc2nccs2)cc1 |
|
~%
N-[4-(1,3-thiaz... CAS#:786-25-4 |
| Literature: Patki; Shirsat Journal of Scientific and Industrial Research, 1959 , vol. 18 C, p. 113,114 |
|
~%
N-[4-(1,3-thiaz... CAS#:786-25-4 |
| Literature: Basu Journal of the Indian Chemical Society, 1949 , vol. 26, p. 130 |
|
~%
N-[4-(1,3-thiaz... CAS#:786-25-4 |
| Literature: Doraswamy; Guha Journal of the Indian Chemical Society, 1946 , vol. 23, p. 273 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| N'4-formyl-N'1-thiazol-2-ylsulfanilamide |
| N4-Formylsulfathiazole |
| N-Formyl-sulfanilsaeure-thiazol-2-ylamid |
| N'4-Formyl-N'1-thiazol-2-ylsulphanilamide |
| 4-formylamino-N-thiazol-2-yl-benzenesulfonamide |
| EINECS 212-325-7 |