3,5,7,8,3′,4′-Hexamethoxyflavone structure
|
Common Name | 3,5,7,8,3′,4′-Hexamethoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 7741-47-1 | Molecular Weight | 402.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3,5,7,8,3′,4′-Hexamethoxyflavone3,5,7,8,3′,4′-Hexamethoxyflavone is a flavonoid. 3,5,7,8,3′,4′-Hexamethoxyflavone can be isolated from the leaves of Melicope triphylla MERR[1]. |
| Name | 2-(3,4-dimethoxyphenyl)-3,5,7,8-tetramethoxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | 3,5,7,8,3′,4′-Hexamethoxyflavone is a flavonoid. 3,5,7,8,3′,4′-Hexamethoxyflavone can be isolated from the leaves of Melicope triphylla MERR[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H22O8 |
|---|---|
| Molecular Weight | 402.39500 |
| Exact Mass | 402.13100 |
| PSA | 85.59000 |
| LogP | 3.51160 |
| InChIKey | XBZIUXVIWRAJKB-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3c(OC)c(OC)cc(OC)c3c(=O)c2OC)cc1OC |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 2-(3,4-dimethoxyphenyl)-3,5,7,8-tetramethoxy-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one,2-(3,4-dimethoxyphenyl)-3,5,7,8-tetramethoxy |
| 3,5,7,8,3',4'-Hexamethoxyflavone |
| 2-(3,4-Dimethoxyphenyl)-3,5,7,8-tetramethoxy-4H-1-benzopyran-4-one |
| Gossypetin hexamethyl ether |