asbestinin-5-acetate structure
|
Common Name | asbestinin-5-acetate | ||
|---|---|---|---|---|
| CAS Number | 75961-67-0 | Molecular Weight | 506.62800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H42O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | asbestinin-5-acetate |
|---|
| Molecular Formula | C28H42O8 |
|---|---|
| Molecular Weight | 506.62800 |
| Exact Mass | 506.28800 |
| PSA | 97.36000 |
| LogP | 3.99250 |
| InChIKey | SPNQDRJAWGBISH-UHFFFAOYSA-N |
| SMILES | C=C1CC2OC3C4C(CC(C)C(OC(=O)CCC)C24)C(C)COC3(C)C(OC(C)=O)CC1OC(C)=O |
|
~53%
asbestinin-5-acetate CAS#:75961-67-0 |
| Literature: Selover, Scott J.; Crews, Phillip; Tagle, Bruce; Clardy, Jon Journal of Organic Chemistry, 1981 , vol. 46, # 5 p. 964 - 970 |
|
~%
asbestinin-5-acetate CAS#:75961-67-0 |
| Literature: Selover, Scott J.; Crews, Phillip; Tagle, Bruce; Clardy, Jon Journal of Organic Chemistry, 1981 , vol. 46, # 5 p. 964 - 970 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |