1,4-bis[2-[di(propan-2-yl)amino]ethylamino]-5,8-dihydroxyanthracene-9,10-dione structure
|
Common Name | 1,4-bis[2-[di(propan-2-yl)amino]ethylamino]-5,8-dihydroxyanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 70945-56-1 | Molecular Weight | 524.69500 | |
| Density | 1.187g/cm3 | Boiling Point | 704.8ºC at 760 mmHg | |
| Molecular Formula | C30H44N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,4-bis[2-[di(propan-2-yl)amino]ethylamino]-5,8-dihydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 704.8ºC at 760 mmHg |
| Molecular Formula | C30H44N4O4 |
| Molecular Weight | 524.69500 |
| Exact Mass | 524.33600 |
| PSA | 105.14000 |
| LogP | 5.08060 |
| Index of Refraction | 1.612 |
| InChIKey | KFWFSXJAESYATH-UHFFFAOYSA-N |
| SMILES | CC(C)N(CCNc1ccc(NCCN(C(C)C)C(C)C)c2c1C(=O)c1c(O)ccc(O)c1C2=O)C(C)C |
|
~%
1,4-bis[2-[di(p... CAS#:70945-56-1 |
| Literature: Murdock,K.C. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, # 9 p. 1024 - 1030 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9,10-Anthracenedione,1,4-bis((2-(bis(1-methylethyl)amino)ethyl)amino)-5,8-dihydroxy |
| 1,4-Bis((2-(bis(1-methylethyl)amino)ethyl)amino)-5,8-dihydroxy-9,10-anthracenedione |
| 1,4-bis{[2-(dipropan-2-ylamino)ethyl]amino}-5,8-dihydroxyanthracene-9,10-dione |