1,4-bis[2-(dimethylamino)ethylamino]-6-methylanthracene-9,10-dione structure
|
Common Name | 1,4-bis[2-(dimethylamino)ethylamino]-6-methylanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 70945-54-9 | Molecular Weight | 394.51000 | |
| Density | 1.203g/cm3 | Boiling Point | 594.1ºC at 760 mmHg | |
| Molecular Formula | C23H30N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 313.1ºC | |
| Name | 1,4-bis[2-(dimethylamino)ethylamino]-6-methylanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.203g/cm3 |
|---|---|
| Boiling Point | 594.1ºC at 760 mmHg |
| Molecular Formula | C23H30N4O2 |
| Molecular Weight | 394.51000 |
| Flash Point | 313.1ºC |
| Exact Mass | 394.23700 |
| PSA | 64.68000 |
| LogP | 2.86340 |
| Index of Refraction | 1.638 |
| InChIKey | PSCSHWDJXRUYPS-UHFFFAOYSA-N |
| SMILES | Cc1ccc2c(c1)C(=O)c1c(NCCN(C)C)ccc(NCCN(C)C)c1C2=O |
|
~%
1,4-bis[2-(dime... CAS#:70945-54-9 |
| Literature: Murdock,K.C. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, # 9 p. 1024 - 1030 |
|
~%
1,4-bis[2-(dime... CAS#:70945-54-9 |
| Literature: Murdock,K.C. et al. Journal of Medicinal Chemistry, 1979 , vol. 22, # 9 p. 1024 - 1030 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1,4-Bis((2-(dimethylamino)ethyl)amino)-6-methyl-9,10-anthracenedione |
| 1,4-bis(2-dimethylaminoethylamino)-6-methyl-anthracene-9,10-dione |