morpholine,prop-2-enoic acid,styrene structure
|
Common Name | morpholine,prop-2-enoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 68310-79-2 | Molecular Weight | 263.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | morpholine,prop-2-enoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H21NO3 |
|---|---|
| Molecular Weight | 263.33200 |
| Exact Mass | 263.15200 |
| PSA | 58.56000 |
| LogP | 2.52160 |
| InChIKey | UYCSZXSDNKOMCV-UHFFFAOYSA-N |
| SMILES | C1COCCN1.C=CC(=O)O.C=Cc1ccccc1 |
| 2-Propenoic acid,polymer with ethenylbenzene,compd. with morpholine |
| Styrene,acrylic acid polymer,morpholine salt |