4-methyl-2-methylidenepentanoic acid,prop-2-enoic acid,styrene structure
|
Common Name | 4-methyl-2-methylidenepentanoic acid,prop-2-enoic acid,styrene | ||
|---|---|---|---|---|
| CAS Number | 27101-83-3 | Molecular Weight | 304.38100 | |
| Density | N/A | Boiling Point | 213.9ºC at 760 mmHg | |
| Molecular Formula | C18H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.4ºC | |
| Name | 4-methyl-2-methylidenepentanoic acid,prop-2-enoic acid,styrene |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 213.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C18H24O4 |
| Molecular Weight | 304.38100 |
| Flash Point | 120.4ºC |
| Exact Mass | 304.16700 |
| PSA | 74.60000 |
| LogP | 4.25990 |
| Vapour Pressure | 0.0623mmHg at 25°C |
| InChIKey | MZMDXZYUYLSNQC-UHFFFAOYSA-N |
| SMILES | C=C(CC(C)C)C(=O)O.C=CC(=O)O.C=Cc1ccccc1 |
| Styrene,isobutyl acrylate,acrylic acid polymer |
| Acrylic acid,polymer with isobutyl acrylate and styrene |
| Acrylic acid,isobutyl acrylate,styrene polymer |
| 4-methyl-2-methylene-pentanoic acid |